Products 2514682-44-9

CAS 2514682-44-9 is the registry number for (Aziridinethyl)aminopropyl Dihydrogen Phosphate. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

3-[2-(aziridin-1-yl)ethylamino]propyl dihydrogen phosphate (CAS 2514682-44-9) is a chemical compound with the molecular formula C7H17N2O4P and a molecular weight of 224.19 g/mol. IUPAC name: 3-[2-(aziridin-1-yl)ethylamino]propyl dihydrogen phosphate. InChIKey: SHVOIWNYOZVIFZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H17N2O4P
Molecular weight224.19 g/mol
IUPAC name3-[2-(aziridin-1-yl)ethylamino]propyl dihydrogen phosphate
InChIKeySHVOIWNYOZVIFZ-UHFFFAOYSA-N
SMILESC1CN1CCNCCCOP(=O)(O)O

Computed by PubChem (NCBI)