CAS 2514709-00-1 is the registry number for (2-(Trifluoromethyl)cyclohexyl)hydrazine Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
[2-(trifluoromethyl)cyclohexyl]hydrazine;hydrochloride (CAS 2514709-00-1) is a chemical compound with the molecular formula C7H14ClF3N2 and a molecular weight of 218.65 g/mol. IUPAC name: [2-(trifluoromethyl)cyclohexyl]hydrazine;hydrochloride. InChIKey: MCAKJRXYRFNSAP-UHFFFAOYSA-N.
| Molecular formula | C7H14ClF3N2 |
|---|---|
| Molecular weight | 218.65 g/mol |
| IUPAC name | [2-(trifluoromethyl)cyclohexyl]hydrazine;hydrochloride |
| InChIKey | MCAKJRXYRFNSAP-UHFFFAOYSA-N |
| SMILES | C1CCC(C(C1)C(F)(F)F)NN.Cl |
Computed by PubChem (NCBI)