CAS 2514709-72-7 is the registry number for Aminochrome Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(4-hydroxyphenyl)butan-2-yl]indole-5,6-diol (CAS 2514709-72-7) is a chemical compound with the molecular formula C18H19NO3 and a molecular weight of 297.3 g/mol. IUPAC name: 1-[4-(4-hydroxyphenyl)butan-2-yl]indole-5,6-diol. InChIKey: FILVNXXNSSBHCS-UHFFFAOYSA-N.
| Molecular formula | C18H19NO3 |
|---|---|
| Molecular weight | 297.3 g/mol |
| IUPAC name | 1-[4-(4-hydroxyphenyl)butan-2-yl]indole-5,6-diol |
| InChIKey | FILVNXXNSSBHCS-UHFFFAOYSA-N |
| SMILES | CC(CCC1=CC=C(C=C1)O)N2C=CC3=CC(=C(C=C32)O)O |
Computed by PubChem (NCBI)