CAS 2514724-36-6 is the registry number for Vonoprazan Impurity 98. Offered by: Chemat Brand. Available pack sizes: on request.
1-[5-(2-fluorophenyl)-1H-pyrrol-3-yl]-N-[[5-(2-fluorophenyl)-1H-pyrrol-3-yl]methyl]methanamine (CAS 2514724-36-6) is a chemical compound with the molecular formula C22H19F2N3 and a molecular weight of 363.4 g/mol. IUPAC name: 1-[5-(2-fluorophenyl)-1H-pyrrol-3-yl]-N-[[5-(2-fluorophenyl)-1H-pyrrol-3-yl]methyl]methanamine. InChIKey: LLGQGQYWXPJEST-UHFFFAOYSA-N.
| Molecular formula | C22H19F2N3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1-[5-(2-fluorophenyl)-1H-pyrrol-3-yl]-N-[[5-(2-fluorophenyl)-1H-pyrrol-3-yl]methyl]methanamine |
| InChIKey | LLGQGQYWXPJEST-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2)CNCC3=CNC(=C3)C4=CC=CC=C4F)F |
Computed by PubChem (NCBI)