CAS 2514742-82-4 is the registry number for Vonoprazan Impurity 132. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(5-chloro-3-pyridinyl)sulfonyl]-5-(2-fluorophenyl)pyrrole-3-carbaldehyde (CAS 2514742-82-4) is a chemical compound with the molecular formula C16H10ClFN2O3S and a molecular weight of 364.8 g/mol. IUPAC name: 1-[(5-chloro-3-pyridinyl)sulfonyl]-5-(2-fluorophenyl)pyrrole-3-carbaldehyde. InChIKey: XMFWDPXFQFPROV-UHFFFAOYSA-N.
| Molecular formula | C16H10ClFN2O3S |
|---|---|
| Molecular weight | 364.8 g/mol |
| IUPAC name | 1-[(5-chloro-3-pyridinyl)sulfonyl]-5-(2-fluorophenyl)pyrrole-3-carbaldehyde |
| InChIKey | XMFWDPXFQFPROV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CN2S(=O)(=O)C3=CC(=CN=C3)Cl)C=O)F |
Computed by PubChem (NCBI)