CAS 25148-85-0 appears in our catalog under these names: Phenylphosphonic acid disodium salt, 95%, Phenylphosphonic Acid Disodium Salt Hydrate, Phenylphosphonic Acid Disodium Salt, >98.0%(T), Sodium phenylphosphonate 95%, Sodium phenylphosphonate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 100g.
Disodium;dioxido-oxo-phenyl-lambda5-phosphane (CAS 25148-85-0) is a chemical compound with the molecular formula C6H5Na2O3P and a molecular weight of 202.05 g/mol. IUPAC name: disodium;dioxido-oxo-phenyl-lambda5-phosphane. InChIKey: JOQAMSDLZYQHMX-UHFFFAOYSA-L.
| Molecular formula | C6H5Na2O3P |
|---|---|
| Molecular weight | 202.05 g/mol |
| IUPAC name | disodium;dioxido-oxo-phenyl-lambda5-phosphane |
| InChIKey | JOQAMSDLZYQHMX-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)