CAS 2514824-23-6 is the registry number for L-Idomiglitol Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
(2S,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride (CAS 2514824-23-6) is a chemical compound with the molecular formula C8H18ClNO5 and a molecular weight of 243.68 g/mol. IUPAC name: (2S,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride. InChIKey: QHWGCVIAMMMOPR-MCHYRWFDSA-N.
| Molecular formula | C8H18ClNO5 |
|---|---|
| Molecular weight | 243.68 g/mol |
| IUPAC name | (2S,3S,4R,5S)-1-(2-hydroxyethyl)-2-(hydroxymethyl)piperidine-3,4,5-triol;hydrochloride |
| InChIKey | QHWGCVIAMMMOPR-MCHYRWFDSA-N |
| SMILES | C1[C@@H]([C@H]([C@H]([C@@H](N1CCO)CO)O)O)O.Cl |
Computed by PubChem (NCBI)