CAS 2514937-17-6 is the registry number for (+)-Limonene 2,3,3,5,5,-d5 (Major), >95% (GC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(4R)-2,3,3,5,5-pentadeuterio-1-methyl-4-prop-1-en-2-ylcyclohexene (CAS 2514937-17-6) is a chemical compound with the molecular formula C10H16 and a molecular weight of 141.26 g/mol. IUPAC name: (4R)-2,3,3,5,5-pentadeuterio-1-methyl-4-prop-1-en-2-ylcyclohexene. InChIKey: XMGQYMWWDOXHJM-PLPAKILYSA-N.
| Molecular formula | C10H16 |
|---|---|
| Molecular weight | 141.26 g/mol |
| IUPAC name | (4R)-2,3,3,5,5-pentadeuterio-1-methyl-4-prop-1-en-2-ylcyclohexene |
| InChIKey | XMGQYMWWDOXHJM-PLPAKILYSA-N |
| SMILES | [2H]C1=C(CC([C@H](C1([2H])[2H])C(=C)C)([2H])[2H])C |
Computed by PubChem (NCBI)