Products 2514948-07-1

CAS 2514948-07-1 is the registry number for 2-(((10-(Benzyloxy)-10-oxodecan-2-yl)oxy)carbonyl)benzoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

2-(10-oxo-10-phenylmethoxydecan-2-yl)oxycarbonylbenzoic acid (CAS 2514948-07-1) is a chemical compound with the molecular formula C25H30O6 and a molecular weight of 426.5 g/mol. IUPAC name: 2-(10-oxo-10-phenylmethoxydecan-2-yl)oxycarbonylbenzoic acid. InChIKey: VGELOXIYYJGIKB-UHFFFAOYSA-N.

Identity
Molecular formulaC25H30O6
Molecular weight426.5 g/mol
IUPAC name2-(10-oxo-10-phenylmethoxydecan-2-yl)oxycarbonylbenzoic acid
InChIKeyVGELOXIYYJGIKB-UHFFFAOYSA-N
SMILESCC(CCCCCCCC(=O)OCC1=CC=CC=C1)OC(=O)C2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)