Products 2514955-48-5

CAS 2514955-48-5 is the registry number for 1,3-Bis(2-((benzyloxy)methyl)phenyl)isobenzofuran. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

5-amino-2-fluoro-4-hydroxybenzoic acid (CAS 2514955-48-5) is a chemical compound with the molecular formula C7H6FNO3 and a molecular weight of 171.13 g/mol. IUPAC name: 5-amino-2-fluoro-4-hydroxybenzoic acid. InChIKey: XPYBCCYMGRHOBE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO3
Molecular weight171.13 g/mol
IUPAC name5-amino-2-fluoro-4-hydroxybenzoic acid
InChIKeyXPYBCCYMGRHOBE-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1N)O)F)C(=O)O

Computed by PubChem (NCBI)