CAS 2514959-57-8 is the registry number for 5-Chloro-2-fluoro-N-(2-hydroxy-5-methoxyphenyl)benzamide. Offered by: TRC. Available pack sizes: 2,5g.
5-chloro-2-fluoro-N-(2-hydroxy-5-methoxyphenyl)benzamide (CAS 2514959-57-8) is a chemical compound with the molecular formula C14H11ClFNO3 and a molecular weight of 295.69 g/mol. IUPAC name: 5-chloro-2-fluoro-N-(2-hydroxy-5-methoxyphenyl)benzamide. InChIKey: DLXRSNLEFATUMG-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO3 |
|---|---|
| Molecular weight | 295.69 g/mol |
| IUPAC name | 5-chloro-2-fluoro-N-(2-hydroxy-5-methoxyphenyl)benzamide |
| InChIKey | DLXRSNLEFATUMG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)O)NC(=O)C2=C(C=CC(=C2)Cl)F |
Computed by PubChem (NCBI)