CAS 251658-55-6 is the registry number for 3-tert-Butyl-1-(4-nitrophenyl)-1h-pyrazol-5-amine, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-amine (CAS 251658-55-6) is a chemical compound with the molecular formula C13H16N4O2 and a molecular weight of 260.29 g/mol. IUPAC name: 3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-amine. InChIKey: WVQSWOBETMRYCD-UHFFFAOYSA-N.
| Molecular formula | C13H16N4O2 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | 3-tert-butyl-1-(4-nitrophenyl)pyrazol-5-amine |
| InChIKey | WVQSWOBETMRYCD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)