Products 2517728-88-8
CAS 2517728-88-8 appears in our catalog under these names: 5-Methylisoxazole-3-carboxylic-d4 Acid Methyl Ester, Methyl 5-methylisoxazole-3-carboxylate-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 100 mg, 10 mg.
Methyl 4-deuterio-5-(trideuteriomethyl)-1,2-oxazole-3-carboxylate (CAS 2517728-88-8) is a chemical compound with the molecular formula C6H7NO3 and a molecular weight of 145.15 g/mol. IUPAC name: methyl 4-deuterio-5-(trideuteriomethyl)-1,2-oxazole-3-carboxylate. InChIKey: MVHHQOCEOUNTID-VYMTUXDUSA-N.
| Molecular formula | C6H7NO3 |
|---|---|
| Molecular weight | 145.15 g/mol |
| IUPAC name | methyl 4-deuterio-5-(trideuteriomethyl)-1,2-oxazole-3-carboxylate |
| InChIKey | MVHHQOCEOUNTID-VYMTUXDUSA-N |
| SMILES | [2H]C1=C(ON=C1C(=O)OC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)