Products 2517968-40-8

CAS 2517968-40-8 is the registry number for Bendamustine Impurity SCR5325. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoate (CAS 2517968-40-8) is a chemical compound with the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. IUPAC name: ethyl 4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoate. InChIKey: DSWOQNHROCJXHX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H22ClN3O2
Molecular weight323.82 g/mol
IUPAC nameethyl 4-[5-(2-chloroethylamino)-1-methylbenzimidazol-2-yl]butanoate
InChIKeyDSWOQNHROCJXHX-UHFFFAOYSA-N
SMILESCCOC(=O)CCCC1=NC2=C(N1C)C=CC(=C2)NCCCl

Computed by PubChem (NCBI)