CAS 2518136-84-8 is the registry number for N-Nitroso Lorcaserin. Offered by: Chemat Brand. Available pack sizes: on request.
(5R)-7-chloro-5-methyl-3-nitroso-1,2,4,5-tetrahydro-3-benzazepine (CAS 2518136-84-8) is a chemical compound with the molecular formula C11H13ClN2O and a molecular weight of 224.68 g/mol. IUPAC name: (5R)-7-chloro-5-methyl-3-nitroso-1,2,4,5-tetrahydro-3-benzazepine. InChIKey: POOKTNWLAMHIKQ-QMMMGPOBSA-N.
| Molecular formula | C11H13ClN2O |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | (5R)-7-chloro-5-methyl-3-nitroso-1,2,4,5-tetrahydro-3-benzazepine |
| InChIKey | POOKTNWLAMHIKQ-QMMMGPOBSA-N |
| SMILES | C[C@H]1CN(CCC2=C1C=C(C=C2)Cl)N=O |
Computed by PubChem (NCBI)