Products 2518198-74-6
CAS 2518198-74-6 is the registry number for N-(1-(4-Chlorophenyl)cyclobutylmethyl)-N,N-dimethylamine Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg.
1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylmethanamine;hydrochloride (CAS 2518198-74-6) is a chemical compound with the molecular formula C13H19Cl2N and a molecular weight of 260.20 g/mol. IUPAC name: 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylmethanamine;hydrochloride. InChIKey: DEVIFWGRBLVZQT-UHFFFAOYSA-N.
| Molecular formula | C13H19Cl2N |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 1-[1-(4-chlorophenyl)cyclobutyl]-N,N-dimethylmethanamine;hydrochloride |
| InChIKey | DEVIFWGRBLVZQT-UHFFFAOYSA-N |
| SMILES | CN(C)CC1(CCC1)C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)