CAS 2518282-93-2 appears in our catalog under these names: Benzbromarone Impurity 2, 2,6-Dibromo-4-(2-ethylbenzofuran-3-carbonyl)phenyl 3,5-Dibromo-4-hydroxybenzoate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
[2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenyl] 3,5-dibromo-4-hydroxybenzoate (CAS 2518282-93-2) is a chemical compound with the molecular formula C24H14Br4O5 and a molecular weight of 702.0 g/mol. IUPAC name: [2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenyl] 3,5-dibromo-4-hydroxybenzoate. InChIKey: JAXGKAILZORHJR-UHFFFAOYSA-N.
| Molecular formula | C24H14Br4O5 |
|---|---|
| Molecular weight | 702.0 g/mol |
| IUPAC name | [2,6-dibromo-4-(2-ethyl-1-benzofuran-3-carbonyl)phenyl] 3,5-dibromo-4-hydroxybenzoate |
| InChIKey | JAXGKAILZORHJR-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)Br)OC(=O)C4=CC(=C(C(=C4)Br)O)Br)Br |
Computed by PubChem (NCBI)