Products 2518426-67-8

CAS 2518426-67-8 is the registry number for Ethyl 3-Amino-4,5-bis(2-methoxyethoxy)benzoate Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate;hydrochloride (CAS 2518426-67-8) is a chemical compound with the molecular formula C15H24ClNO6 and a molecular weight of 349.81 g/mol. IUPAC name: ethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate;hydrochloride. InChIKey: MKFCOYUVEJWJEU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24ClNO6
Molecular weight349.81 g/mol
IUPAC nameethyl 3-amino-4,5-bis(2-methoxyethoxy)benzoate;hydrochloride
InChIKeyMKFCOYUVEJWJEU-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=C(C(=C1)OCCOC)OCCOC)N.Cl

Computed by PubChem (NCBI)