Products 25195-44-2
CAS 25195-44-2 is the registry number for 2,4-Difluorobenzylmethylsulfone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
2,4-difluoro-1-(methylsulfonylmethyl)benzene (CAS 25195-44-2) is a chemical compound with the molecular formula C8H8F2O2S and a molecular weight of 206.21 g/mol. IUPAC name: 2,4-difluoro-1-(methylsulfonylmethyl)benzene. InChIKey: NEFFOLXTDBJOML-UHFFFAOYSA-N.
| Molecular formula | C8H8F2O2S |
|---|---|
| Molecular weight | 206.21 g/mol |
| IUPAC name | 2,4-difluoro-1-(methylsulfonylmethyl)benzene |
| InChIKey | NEFFOLXTDBJOML-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)