Products 25198-22-5
CAS 25198-22-5 is the registry number for Basic red 18. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium chloride (CAS 25198-22-5) is a chemical compound with the molecular formula C19H25Cl2N5O2 and a molecular weight of 426.3 g/mol. IUPAC name: 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium chloride. InChIKey: ZFRUNHQZTYGGDY-UHFFFAOYSA-M.
| Molecular formula | C19H25Cl2N5O2 |
|---|---|
| Molecular weight | 426.3 g/mol |
| IUPAC name | 2-[4-[(2-chloro-4-nitrophenyl)diazenyl]-N-ethylanilino]ethyl-trimethylazanium chloride |
| InChIKey | ZFRUNHQZTYGGDY-UHFFFAOYSA-M |
| SMILES | CCN(CC[N+](C)(C)C)C1=CC=C(C=C1)N=NC2=C(C=C(C=C2)[N+](=O)[O-])Cl.[Cl-] |
Computed by PubChem (NCBI)