CAS 2519850-13-4 is the registry number for N-Dicarbamyl-L-glutamic Acid. Offered by: TRC. Available pack sizes: 5mg.
(2S)-2-(dicarbamoylamino)pentanedioic acid (CAS 2519850-13-4) is a chemical compound with the molecular formula C7H11N3O6 and a molecular weight of 233.18 g/mol. IUPAC name: (2S)-2-(dicarbamoylamino)pentanedioic acid. InChIKey: QNZIVEOJFKBWPJ-VKHMYHEASA-N.
| Molecular formula | C7H11N3O6 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | (2S)-2-(dicarbamoylamino)pentanedioic acid |
| InChIKey | QNZIVEOJFKBWPJ-VKHMYHEASA-N |
| SMILES | C(CC(=O)O)[C@@H](C(=O)O)N(C(=O)N)C(=O)N |
Computed by PubChem (NCBI)