CAS 2519851-20-6 is the registry number for (S)-2-Amino-3-(4-(4-bromobutoxy)phenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride (CAS 2519851-20-6) is a chemical compound with the molecular formula C13H19BrClNO3 and a molecular weight of 352.65 g/mol. IUPAC name: (2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride. InChIKey: YEKMSQXWRXEHEO-YDALLXLXSA-N.
| Molecular formula | C13H19BrClNO3 |
|---|---|
| Molecular weight | 352.65 g/mol |
| IUPAC name | (2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride |
| InChIKey | YEKMSQXWRXEHEO-YDALLXLXSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)O)N)OCCCCBr.Cl |
Computed by PubChem (NCBI)