Products 2519851-20-6

CAS 2519851-20-6 is the registry number for (S)-2-Amino-3-(4-(4-bromobutoxy)phenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride (CAS 2519851-20-6) is a chemical compound with the molecular formula C13H19BrClNO3 and a molecular weight of 352.65 g/mol. IUPAC name: (2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride. InChIKey: YEKMSQXWRXEHEO-YDALLXLXSA-N.

Identity
Molecular formulaC13H19BrClNO3
Molecular weight352.65 g/mol
IUPAC name(2S)-2-amino-3-[4-(4-bromobutoxy)phenyl]propanoic acid;hydrochloride
InChIKeyYEKMSQXWRXEHEO-YDALLXLXSA-N
SMILESC1=CC(=CC=C1C[C@@H](C(=O)O)N)OCCCCBr.Cl

Computed by PubChem (NCBI)