Products 252006-38-5

CAS 252006-38-5 is the registry number for 3,4-dideoxyglucosone-3-ene. Offered by: Chemat Brand, Biosynth, Chemat. Available pack sizes: on request, 2mg, 1mg, 10mg, 5mg, 25mg.

Structural formula: {0} (CAS {1})

(2R)-6-hydroxy-2-(hydroxymethyl)-2H-pyran-5-one (CAS 252006-38-5) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 144.12 g/mol. IUPAC name: (2R)-6-hydroxy-2-(hydroxymethyl)-2H-pyran-5-one. InChIKey: WNKYVCKDIDTELO-NJXYFUOMSA-N.

Identity
Molecular formulaC6H8O4
Molecular weight144.12 g/mol
IUPAC name(2R)-6-hydroxy-2-(hydroxymethyl)-2H-pyran-5-one
InChIKeyWNKYVCKDIDTELO-NJXYFUOMSA-N
SMILESC1=CC(=O)C(O[C@H]1CO)O

Computed by PubChem (NCBI)