CAS 252026-54-3 is the registry number for 1,1–Bis(4–chlorophenyl)–2–((4–chlorophenyl)thio)ethanol. Offered by: GLPBio. Available pack sizes: 1g.
1,1-bis(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylethanol (CAS 252026-54-3) is a chemical compound with the molecular formula C20H15Cl3OS and a molecular weight of 409.8 g/mol. IUPAC name: 1,1-bis(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylethanol. InChIKey: SXVUNLUEGXMDGO-UHFFFAOYSA-N.
| Molecular formula | C20H15Cl3OS |
|---|---|
| Molecular weight | 409.8 g/mol |
| IUPAC name | 1,1-bis(4-chlorophenyl)-2-(4-chlorophenyl)sulfanylethanol |
| InChIKey | SXVUNLUEGXMDGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CSC2=CC=C(C=C2)Cl)(C3=CC=C(C=C3)Cl)O)Cl |
Computed by PubChem (NCBI)