CAS 25211-86-3 appears in our catalog under these names: Etidronic acid monohydrate, 95%, (1-Hydroxyethane-1,1-diyl)bis(phosphonic acid) hydrate, 95+%, Etidronic acid monohydrate, Etidronic acid monohydrate, 98.00%, ETIDRONIC ACID MONOHYDRATE, >=95.0%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Sigma-Aldrich. Available pack sizes: 100g, 1g, 5g, 25g, 500g, 10G, 50G, 1 g.
(1-hydroxy-1-phosphonoethyl)phosphonic acid;hydrate (CAS 25211-86-3) is a chemical compound with the molecular formula C2H10O8P2 and a molecular weight of 224.04 g/mol. IUPAC name: (1-hydroxy-1-phosphonoethyl)phosphonic acid;hydrate. InChIKey: KKNZXUHBWLPUFN-UHFFFAOYSA-N.
| Molecular formula | C2H10O8P2 |
|---|---|
| Molecular weight | 224.04 g/mol |
| IUPAC name | (1-hydroxy-1-phosphonoethyl)phosphonic acid;hydrate |
| InChIKey | KKNZXUHBWLPUFN-UHFFFAOYSA-N |
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.O |
Computed by PubChem (NCBI)