Products 2521777-38-6
CAS 2521777-38-6 is the registry number for Anticancer agent 51. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea (CAS 2521777-38-6) is a chemical compound with the molecular formula C22H20F3N3O2S and a molecular weight of 447.5 g/mol. IUPAC name: 1-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea. InChIKey: DAUFGNVJEFCGLD-ZDUSSCGKSA-N.
| Molecular formula | C22H20F3N3O2S |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 1-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]-3-[4-(trifluoromethyl)phenyl]thiourea |
| InChIKey | DAUFGNVJEFCGLD-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)NNC(=S)NC3=CC=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
Anticancer agent 51, orb1687377