CAS 25218-22-8 appears in our catalog under these names: 4-Aminophenyl 2,3,4-Tri-O-acetyl-Beta-D-glucuronide Methyl Ester, 4-Aminophenyl 2,3,4-tri-O-acetyl-b-D-glucuronide methyl ester. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 50mg, 25mg, 10mg.
Methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylate (CAS 25218-22-8) is a chemical compound with the molecular formula C19H23NO10 and a molecular weight of 425.4 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylate. InChIKey: IGHOHCWHGMRAMB-YTGMWSOZSA-N.
| Molecular formula | C19H23NO10 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(4-aminophenoxy)oxane-2-carboxylate |
| InChIKey | IGHOHCWHGMRAMB-YTGMWSOZSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=CC=C(C=C2)N)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)