CAS 252188-98-0 is the registry number for 4,4',4''-(Benzene-1,3,5-triyltris(ethene-2,1-diyl))tribenzaldehyde, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[2-[3,5-bis[2-(4-formylphenyl)ethenyl]phenyl]ethenyl]benzaldehyde (CAS 252188-98-0) is a chemical compound with the molecular formula C33H24O3 and a molecular weight of 468.5 g/mol. IUPAC name: 4-[2-[3,5-bis[2-(4-formylphenyl)ethenyl]phenyl]ethenyl]benzaldehyde. InChIKey: APQQHVVRTIWJRG-UHFFFAOYSA-N.
| Molecular formula | C33H24O3 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 4-[2-[3,5-bis[2-(4-formylphenyl)ethenyl]phenyl]ethenyl]benzaldehyde |
| InChIKey | APQQHVVRTIWJRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC2=CC(=CC(=C2)C=CC3=CC=C(C=C3)C=O)C=CC4=CC=C(C=C4)C=O)C=O |
Computed by PubChem (NCBI)