CAS 25221-53-8 is the registry number for Creatinine Phosphoric Dichloride. Offered by: Chemat Brand. Available pack sizes: on request.
2-dichlorophosphorylimino-1-methylimidazolidin-4-one (CAS 25221-53-8) is a chemical compound with the molecular formula C4H6Cl2N3O2P and a molecular weight of 229.99 g/mol. IUPAC name: 2-dichlorophosphorylimino-1-methylimidazolidin-4-one. InChIKey: LLAFVXRGNOJWJX-UHFFFAOYSA-N.
| Molecular formula | C4H6Cl2N3O2P |
|---|---|
| Molecular weight | 229.99 g/mol |
| IUPAC name | 2-dichlorophosphorylimino-1-methylimidazolidin-4-one |
| InChIKey | LLAFVXRGNOJWJX-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC1=NP(=O)(Cl)Cl |
Computed by PubChem (NCBI)