CAS 252237-40-4 appears in our catalog under these names: (1H,1H,2H,2H-Tridecafluorooct-1-yl)phosphonic acid, 95%, 1H,1H,2H,2H-Perfluorooctanephosphonic acid, 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctylphosphonic acid, 1H,1H,2H,2H-PERFLUOROOCTANEPHOSPHONIC A&, (1H,1H,2H,2H-Tridecafluorooct-1-yl)phosphonic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Dr. Ehrenstorfer, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 50mg, 10g, 25g, 250mg.
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid (CAS 252237-40-4) is a chemical compound with the molecular formula C8H6F13O3P and a molecular weight of 428.08 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid. InChIKey: DEXIXSRZQUFPIK-UHFFFAOYSA-N.
| Molecular formula | C8H6F13O3P |
|---|---|
| Molecular weight | 428.08 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctylphosphonic acid |
| InChIKey | DEXIXSRZQUFPIK-UHFFFAOYSA-N |
| SMILES | C(CP(=O)(O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)