Products 2522597-99-3
CAS 2522597-99-3 is the registry number for Garcixanthones B, ≥98%. Offered by: Chemat. Available pack sizes: 5mg.
1,3,8-trihydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one (CAS 2522597-99-3) is a chemical compound with the molecular formula C23H24O5 and a molecular weight of 380.4 g/mol. IUPAC name: 1,3,8-trihydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one. InChIKey: DXFABLPVCVJGMJ-UHFFFAOYSA-N.
| Molecular formula | C23H24O5 |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | 1,3,8-trihydroxy-2,4-bis(3-methylbut-2-enyl)xanthen-9-one |
| InChIKey | DXFABLPVCVJGMJ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C2C(=C1O)C(=O)C3=C(C=CC=C3O2)O)CC=C(C)C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Garcixanthones B