CAS 2523-39-9 appears in our catalog under these names: 3-Methyl-9h-fluorene, 95%, 3-Methyl-9H-fluorene. Offered by: Combi-blocks, TRC. Available pack sizes: 100mg, 500mg, 250mg.
3-methyl-9H-fluorene (CAS 2523-39-9) is a chemical compound with the molecular formula C14H12 and a molecular weight of 180.24 g/mol. IUPAC name: 3-methyl-9H-fluorene. InChIKey: GVSRMRNALQEEEI-UHFFFAOYSA-N.
| Molecular formula | C14H12 |
|---|---|
| Molecular weight | 180.24 g/mol |
| IUPAC name | 3-methyl-9H-fluorene |
| InChIKey | GVSRMRNALQEEEI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(CC3=CC=CC=C32)C=C1 |
Computed by PubChem (NCBI)