CAS 252317-48-9 appears in our catalog under these names: Darifenacin Impurity 1, Darifenacin Impurity 4, (S)-Darifenacin Nitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[(3S)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetonitrile (CAS 252317-48-9) is a chemical compound with the molecular formula C28H28N2O and a molecular weight of 408.5 g/mol. IUPAC name: 2-[(3S)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetonitrile. InChIKey: NPYLNMONSZSLSP-ZTDHTWSHSA-N.
| Molecular formula | C28H28N2O |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-[(3S)-1-[1-(2,3-dihydro-1-benzofuran-5-yl)ethyl]pyrrolidin-3-yl]-2,2-diphenylacetonitrile |
| InChIKey | NPYLNMONSZSLSP-ZTDHTWSHSA-N |
| SMILES | CC(C1=CC2=C(C=C1)OCC2)N3CC[C@H](C3)C(C#N)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)