Products 2523200-21-5

CAS 2523200-21-5 is the registry number for 1-Iodo-3-methoxy-2-phenoxybenzene 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

1-iodo-3-methoxy-2-phenoxybenzene (CAS 2523200-21-5) is a chemical compound with the molecular formula C13H11IO2 and a molecular weight of 326.13 g/mol. IUPAC name: 1-iodo-3-methoxy-2-phenoxybenzene. InChIKey: YFRIOZFRCMFSGN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11IO2
Molecular weight326.13 g/mol
IUPAC name1-iodo-3-methoxy-2-phenoxybenzene
InChIKeyYFRIOZFRCMFSGN-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)I)OC2=CC=CC=C2

Computed by PubChem (NCBI)