CAS 252332-05-1 is the registry number for 1,7-Dibromo-3,3,4-trimethylbicyclo[2.2.1]heptan-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1,7-dibromo-3,3,4-trimethylbicyclo[2.2.1]heptan-2-one (CAS 252332-05-1) is a chemical compound with the molecular formula C10H14Br2O and a molecular weight of 310.03 g/mol. IUPAC name: 1,7-dibromo-3,3,4-trimethylbicyclo[2.2.1]heptan-2-one. InChIKey: GAYCFDDDUIMMOM-UHFFFAOYSA-N.
| Molecular formula | C10H14Br2O |
|---|---|
| Molecular weight | 310.03 g/mol |
| IUPAC name | 1,7-dibromo-3,3,4-trimethylbicyclo[2.2.1]heptan-2-one |
| InChIKey | GAYCFDDDUIMMOM-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)C2(CCC1(C2Br)C)Br)C |
Computed by PubChem (NCBI)