CAS 2524-64-3 appears in our catalog under these names: Diphenyl chlorophosphate, 97%, Rufinamide Impurity 12, Diphenyl Chlorophosphonate, Diphenyl phosphoryl chloride, Diphenyl phosphorochloridate, 97% . Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 100g, 500g, 5g, 25g, on request, 50g, 1000g, 250g.
[chloro(phenoxy)phosphoryl]oxybenzene (CAS 2524-64-3) is a chemical compound with the molecular formula C12H10ClO3P and a molecular weight of 268.63 g/mol. IUPAC name: [chloro(phenoxy)phosphoryl]oxybenzene. InChIKey: BHIIGRBMZRSDRI-UHFFFAOYSA-N.
| Molecular formula | C12H10ClO3P |
|---|---|
| Molecular weight | 268.63 g/mol |
| IUPAC name | [chloro(phenoxy)phosphoryl]oxybenzene |
| InChIKey | BHIIGRBMZRSDRI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)