Products 2525175-31-7
CAS 2525175-31-7 appears in our catalog under these names: (±)15–HETE–d8, (±)15-HETE-d8. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, 5mg, 1mg.
(5Z,8Z,11Z,13E)-5,6,8,9,11,12,14,15-octadeuterio-15-hydroxyicosa-5,8,11,13-tetraenoic acid (CAS 2525175-31-7) is a chemical compound with the molecular formula C20H32O3 and a molecular weight of 328.5 g/mol. IUPAC name: (5Z,8Z,11Z,13E)-5,6,8,9,11,12,14,15-octadeuterio-15-hydroxyicosa-5,8,11,13-tetraenoic acid. InChIKey: JSFATNQSLKRBCI-HAVWKUCESA-N.
| Molecular formula | C20H32O3 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (5Z,8Z,11Z,13E)-5,6,8,9,11,12,14,15-octadeuterio-15-hydroxyicosa-5,8,11,13-tetraenoic acid |
| InChIKey | JSFATNQSLKRBCI-HAVWKUCESA-N |
| SMILES | [2H]/C(=C(\[2H])/C/C(=C(/[2H])\C\C(=C(\[2H])/C=C(\[2H])/C([2H])(CCCCC)O)\[2H])/[2H])/CCCC(=O)O |
Computed by PubChem (NCBI)