Products 252555-36-5

CAS 252555-36-5 is the registry number for 4-Fluoro-3,5-dimethylphenyl methyl sulfide, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-1,3-dimethyl-5-methylsulfanylbenzene (CAS 252555-36-5) is a chemical compound with the molecular formula C9H11FS and a molecular weight of 170.25 g/mol. IUPAC name: 2-fluoro-1,3-dimethyl-5-methylsulfanylbenzene. InChIKey: IVDAILVWVBSNOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11FS
Molecular weight170.25 g/mol
IUPAC name2-fluoro-1,3-dimethyl-5-methylsulfanylbenzene
InChIKeyIVDAILVWVBSNOJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1F)C)SC

Computed by PubChem (NCBI)