Products 252564-93-5
CAS 252564-93-5 is the registry number for Cyhalofop amide. Offered by: HPC Standards. Available pack sizes: 1x10mg.
(2R)-2-[4-(4-carbamoyl-2-fluorophenoxy)phenoxy]propanoic acid (CAS 252564-93-5) is a chemical compound with the molecular formula C16H14FNO5 and a molecular weight of 319.28 g/mol. IUPAC name: (2R)-2-[4-(4-carbamoyl-2-fluorophenoxy)phenoxy]propanoic acid. InChIKey: KLAXHJVWONQIPF-SECBINFHSA-N.
| Molecular formula | C16H14FNO5 |
|---|---|
| Molecular weight | 319.28 g/mol |
| IUPAC name | (2R)-2-[4-(4-carbamoyl-2-fluorophenoxy)phenoxy]propanoic acid |
| InChIKey | KLAXHJVWONQIPF-SECBINFHSA-N |
| SMILES | C[C@H](C(=O)O)OC1=CC=C(C=C1)OC2=C(C=C(C=C2)C(=O)N)F |
Computed by PubChem (NCBI)