CAS 252577-14-3 appears in our catalog under these names: 4-Chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine, 95%, 4-Chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine, 95+%, 4–Chloro–6–(2–fluoropropan–2–yl)–1,3,5–triazin–2–amine, 4-chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg, 0,5g.
4-chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine (CAS 252577-14-3) is a chemical compound with the molecular formula C6H8ClFN4 and a molecular weight of 190.60 g/mol. IUPAC name: 4-chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine. InChIKey: QLGAUXJYKAVRNE-UHFFFAOYSA-N.
| Molecular formula | C6H8ClFN4 |
|---|---|
| Molecular weight | 190.60 g/mol |
| IUPAC name | 4-chloro-6-(2-fluoropropan-2-yl)-1,3,5-triazin-2-amine |
| InChIKey | QLGAUXJYKAVRNE-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC(=NC(=N1)Cl)N)F |
Computed by PubChem (NCBI)