Products 252647-51-1
CAS 252647-51-1 appears in our catalog under these names: (R)-Naroparcil/ 98.21% (existing batch purity), (2R)-Naroparcil, (R)-Naroparcil. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
4-[4-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzoyl]benzonitrile (CAS 252647-51-1) is a chemical compound with the molecular formula C19H17NO4S2 and a molecular weight of 387.5 g/mol. IUPAC name: 4-[4-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzoyl]benzonitrile. InChIKey: IMAFEPKOGMHYNH-QXCFHYIPSA-N.
| Molecular formula | C19H17NO4S2 |
|---|---|
| Molecular weight | 387.5 g/mol |
| IUPAC name | 4-[4-[(2R,3R,4S,5S)-3,4,5-trihydroxythian-2-yl]sulfanylbenzoyl]benzonitrile |
| InChIKey | IMAFEPKOGMHYNH-QXCFHYIPSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H](S1)SC2=CC=C(C=C2)C(=O)C3=CC=C(C=C3)C#N)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(R)-Naroparcil, orb1905857