Products 2527915-11-1
CAS 2527915-11-1 is the registry number for Zika virus-IN-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,3aS)-2-anilino-1-(4-chlorophenyl)-1,3a,4,5-tetrahydroimidazo[1,5-a]quinolin-3-one (CAS 2527915-11-1) is a chemical compound with the molecular formula C23H20ClN3O and a molecular weight of 389.9 g/mol. IUPAC name: (1R,3aS)-2-anilino-1-(4-chlorophenyl)-1,3a,4,5-tetrahydroimidazo[1,5-a]quinolin-3-one. InChIKey: ICHSJORBEYZBSZ-FCHUYYIVSA-N.
| Molecular formula | C23H20ClN3O |
|---|---|
| Molecular weight | 389.9 g/mol |
| IUPAC name | (1R,3aS)-2-anilino-1-(4-chlorophenyl)-1,3a,4,5-tetrahydroimidazo[1,5-a]quinolin-3-one |
| InChIKey | ICHSJORBEYZBSZ-FCHUYYIVSA-N |
| SMILES | C1CC2=CC=CC=C2N3[C@@H]1C(=O)N([C@@H]3C4=CC=C(C=C4)Cl)NC5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
Zika virus-IN-3, orb1688276