Products 252898-57-0
CAS 252898-57-0 is the registry number for 5-(tert-Butyl)-2-ethoxybenzene-1-sulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-tert-butyl-2-ethoxybenzenesulfonyl chloride (CAS 252898-57-0) is a chemical compound with the molecular formula C12H17ClO3S and a molecular weight of 276.78 g/mol. IUPAC name: 5-tert-butyl-2-ethoxybenzenesulfonyl chloride. InChIKey: MLWWGRKAGTUUGF-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO3S |
|---|---|
| Molecular weight | 276.78 g/mol |
| IUPAC name | 5-tert-butyl-2-ethoxybenzenesulfonyl chloride |
| InChIKey | MLWWGRKAGTUUGF-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)C(C)(C)C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)