CAS 252930-37-3 appears in our catalog under these names: (S)–2–Amino–3–(5–(tert–butyl)–3–(phosphonomethoxy)isoxazol–4–yl)propanoic acid, (S)-2-Amino-3-(5-(tert-butyl)-3-(phosphonomethoxy)isoxazol-4-yl)propanoic acid, 95%, 95%, Atpo, 95%, (S)-ATPO/ 99.41% (existing batch purity), ATPO. Offered by: GLPBio, Chemat, Combi-blocks, TargetMol, Biosynth. Available pack sizes: 25mg, 5mg, 50mg, 100mg, 1mg, 2mg, 10mg, 1 mg.
2-amino-3-[5-tert-butyl-3-(phosphonomethoxy)-1,2-oxazol-4-yl]propanoic acid (CAS 252930-37-3) is a chemical compound with the molecular formula C11H19N2O7P and a molecular weight of 322.25 g/mol. IUPAC name: 2-amino-3-[5-tert-butyl-3-(phosphonomethoxy)-1,2-oxazol-4-yl]propanoic acid. InChIKey: AGSOOCUNMTYPSE-UHFFFAOYSA-N.
| Molecular formula | C11H19N2O7P |
|---|---|
| Molecular weight | 322.25 g/mol |
| IUPAC name | 2-amino-3-[5-tert-butyl-3-(phosphonomethoxy)-1,2-oxazol-4-yl]propanoic acid |
| InChIKey | AGSOOCUNMTYPSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C(=NO1)OCP(=O)(O)O)CC(C(=O)O)N |
Computed by PubChem (NCBI)