CAS 252963-13-6 is the registry number for (1S)-1-(3,4-Dichlorophenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1S)-1-(3,4-dichlorophenyl)ethanol (CAS 252963-13-6) is a chemical compound with the molecular formula C8H8Cl2O and a molecular weight of 191.05 g/mol. IUPAC name: (1S)-1-(3,4-dichlorophenyl)ethanol. InChIKey: VZTGSONNNMGQNQ-YFKPBYRVSA-N.
| Molecular formula | C8H8Cl2O |
|---|---|
| Molecular weight | 191.05 g/mol |
| IUPAC name | (1S)-1-(3,4-dichlorophenyl)ethanol |
| InChIKey | VZTGSONNNMGQNQ-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)Cl)Cl)O |
Computed by PubChem (NCBI)