CAS 252977-51-8 appears in our catalog under these names: TPA 023, 97%, TPA 023/ 99.06% (existing batch purity), TPA 023, TPA 023, 7-(tert-Butyl)-6-((1-ethyl-1H-1,2,4-triazol-5-yl)methoxy)-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine, 99.75% ,, 99.75% ,. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
7-tert-butyl-6-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 252977-51-8) is a chemical compound with the molecular formula C20H22FN7O and a molecular weight of 395.4 g/mol. IUPAC name: 7-tert-butyl-6-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: QKIWQBLNTSQOLY-UHFFFAOYSA-N.
| Molecular formula | C20H22FN7O |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | 7-tert-butyl-6-[(2-ethyl-1,2,4-triazol-3-yl)methoxy]-3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | QKIWQBLNTSQOLY-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC=N1)COC2=NN3C(=NN=C3C4=CC=CC=C4F)C=C2C(C)(C)C |
Computed by PubChem (NCBI)