CAS 252979-43-4 appears in our catalog under these names: MRE-3008F20, MRE3008F20/ 97.66% (existing batch purity), MRE 3008F20, MRE3008F20, 97.29% ,, 97.29% ,, MRE3008F20, 99.70%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 750mg.
1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methoxyphenyl)urea (CAS 252979-43-4) is a chemical compound with the molecular formula C21H20N8O3 and a molecular weight of 432.4 g/mol. IUPAC name: 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methoxyphenyl)urea. InChIKey: CJRNHKSLHHWUAB-UHFFFAOYSA-N.
| Molecular formula | C21H20N8O3 |
|---|---|
| Molecular weight | 432.4 g/mol |
| IUPAC name | 1-[4-(furan-2-yl)-11-propyl-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaen-7-yl]-3-(4-methoxyphenyl)urea |
| InChIKey | CJRNHKSLHHWUAB-UHFFFAOYSA-N |
| SMILES | CCCN1C=C2C(=N1)N=C(N3C2=NC(=N3)C4=CC=CO4)NC(=O)NC5=CC=C(C=C5)OC |
Computed by PubChem (NCBI)