CAS 252985-90-3 is the registry number for Argatroban Impurity 43. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5-(diaminomethylideneamino)-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoic acid (CAS 252985-90-3) is a chemical compound with the molecular formula C16H21N5O4S and a molecular weight of 379.4 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoic acid. InChIKey: APQNAWDCTSKKDD-LBPRGKRZSA-N.
| Molecular formula | C16H21N5O4S |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoic acid |
| InChIKey | APQNAWDCTSKKDD-LBPRGKRZSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)S(=O)(=O)N[C@@H](CCCN=C(N)N)C(=O)O)N=C1 |
Computed by PubChem (NCBI)