CAS 252990-29-7 appears in our catalog under these names: Benflumetol Impurity 2, (E,Z)-9-(4-Chlorophenyl)methylene-5-oxiranyl-2,7-dichlorofluorene. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 5mg.
2-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]oxirane (CAS 252990-29-7) is a chemical compound with the molecular formula C22H13Cl3O and a molecular weight of 399.7 g/mol. IUPAC name: 2-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]oxirane. InChIKey: AWVLNBDLCIBSLB-REZTVBANSA-N.
| Molecular formula | C22H13Cl3O |
|---|---|
| Molecular weight | 399.7 g/mol |
| IUPAC name | 2-[(9E)-2,7-dichloro-9-[(4-chlorophenyl)methylidene]fluoren-4-yl]oxirane |
| InChIKey | AWVLNBDLCIBSLB-REZTVBANSA-N |
| SMILES | C1C(O1)C2=C3C4=C(C=C(C=C4)Cl)/C(=C\C5=CC=C(C=C5)Cl)/C3=CC(=C2)Cl |
Computed by PubChem (NCBI)