Products 2530162-00-4
CAS 2530162-00-4 appears in our catalog under these names: HBC599, HBC599, 98.75%. Offered by: GLPBio, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg.
4-[(Z)-1-cyano-2-[6-[2-hydroxyethyl(methyl)amino]-1-benzothiophen-2-yl]ethenyl]benzonitrile (CAS 2530162-00-4) is a chemical compound with the molecular formula C21H17N3OS and a molecular weight of 359.4 g/mol. IUPAC name: 4-[(Z)-1-cyano-2-[6-[2-hydroxyethyl(methyl)amino]-1-benzothiophen-2-yl]ethenyl]benzonitrile. InChIKey: WXTHEUULEXARCU-WOJGMQOQSA-N.
| Molecular formula | C21H17N3OS |
|---|---|
| Molecular weight | 359.4 g/mol |
| IUPAC name | 4-[(Z)-1-cyano-2-[6-[2-hydroxyethyl(methyl)amino]-1-benzothiophen-2-yl]ethenyl]benzonitrile |
| InChIKey | WXTHEUULEXARCU-WOJGMQOQSA-N |
| SMILES | CN(CCO)C1=CC2=C(C=C1)C=C(S2)/C=C(\C#N)/C3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)